Студенческая. Учебная работа № 56041. Контрольная Химия — ХИ

1 Звезда2 Звезды3 Звезды4 Звезды5 Звезд (6 оценок, среднее: 4,67 из 5)
Загрузка...

учебная работа № 56041. Контрольная Химия — хи

Количество страниц учебной работы: 0
содержание:
ответы на тест

Задание 1
вопрос 1. Какие из приведенных соединений относятся к основным оксидам: а)NO, б)MgO, в)BaO2, г)Na2O, д) Mn2O7?
1. а, д
2. в, г
3. б, г
4. в, д
5. а, б
Вопрос 2.С какими из перечисленных веществ будет взаимодействовать оксид кальция: а)H2O, б)PbO, в)CO2, г)NaCl, д)HCl?
1. а, в
2. а, в, д
3. б, в, г
4. в, г, д
5. а, г, д
Вопрос 3. какие из приведенных веществ относятся к кислотным оксидам: а)CrO3, б)CO, в)N2O5, г)BaO, д)SnO?
1. а, в
2. а, б, в
3. в, д
4. а, б
5. б, в, г
вопрос 4. С какими из перечисленных веществ будет взаимодействовать оксид серы (VI): а)Ba(OH)2, б)KI, в)H2O, г)CaO, д)H2S?
1. а, в, г
2. б, в, г
3. в, г, д
4. а, в, д
5. а, б, д
вопрос 5. Какие из перечисленных оксидов относятся к несолеобразующим: а)CoO, б)N2O, в)CO, г)N2O5, д)NO
1. а, б, г
2. б, в, д
3. б, в, г
4. в, г, д
5. а, в, д

Задание 2
Вопрос 1. какие из перечисленных веществ относятся к основаниям: а)KOH, б)CH3OH, в)Ge(OH)4, г)Cu(OH)2, д)Sr(OH)2?
1. а, в, г
2. а, г, д
3. б, в, г
4. в, г, д
5. а, в, д
Вопрос 2. какие из перечисленных оксидов при взаимодействии с водой дают растворимые основания (щелочи): а)BaO, б)CuO, в)Li2O, г)MgO, д)Al2O3?
1. а, в
2. а, в, г
3. в, г
4. б, г, д
5. б, д
вопрос 3. Какие из перечисленных гидроксидов при нагревании разлагаются на оксид и воду: а)KOH, б)Ca(OH)2, в)Ba(OH)2, г)Fe(OH)3, д)Al(OH)3?
1. а, б, в
2. б, г, д
3. г, д
4. б, в, г
5. в, г
Вопрос 4. С какими из перечисленных веществ будет взаимодействовать гидроксид натрия: а)HNO3, б)BaSO4, в)SO2, г)FeO, д)CuCl2?
1. а, в, д
2. в, д
3. а, б, в
4. в, г, д
5. б, г
вопрос 5. С какими из перечисленных веществ будет взаимодействовать гидроксид меди: а)HCl, б)BaCl2, в)CO2, г)H2SO4, д)KCl?
1. а, б
2. а, г
3. в, г
4. а, в, г
5. в, г, д

задание 3
Вопрос 1. Какие из перечисленных веществ относятся к амфотерным оксидам: а)CoO, б)ZnO,, в)Cr2O3, г)MgO, д)BeO?
1. а, б, в
2. б, в, г
3. в, г, д
4. б, г, д
5. б, в, д
вопрос 2. С какими из перечисленных веществ будет взаимодействовать оксид алюминия: а)NaOH, б)CO2, в)HCl, г)Li2O, д)SiO2?
1. а, в, г, д
2. а, б, в, д
3. б, в, г
4. в, г. д
5. а, б, г, д
вопрос 3. Какие из перечисленных веществ относятся к амфотерным гидроксидам: а)Fe(OH)2, б)Al(OH)3, в)Ca(OH)2, г)Zn(OH)2 д)Ni(OH)2?
1. а, б, в
2. б, г, д
3. в, г
4. г, д
5. б, г
вопрос 4. С какими из перечисленных веществ будет взаимодействовать гидроксид хрома (III): а)SO2, б)NaOH, в)H2SO4, г)KNO3, д)Cu(OH)2?
1. а, б,
2. б, в
3. б, в, д
4. в, г, д
5. б, д
вопрос 5. Что будет происходить с гидроксидом цинка при нагревании? Напишите соответствующее уравнение реакции. Укажите сумму коэффициентов в этом уравнении:
1. 3
2. 4
3. 5
4. 6
5. 7

задание 4.
Вопрос 1. Укажите формулы хлорной, марганцовистой, ортофосфорной кислот:
1. HClO, H2MnO4, HPO3
2. HCl, HMnO¬4, H3PO4
3. HClO4, H2MnO4, H3PO4
4. HClO3, H2MnO4, H3PO4
5. HClO4, HMnO4, HPO2
вопрос 2. Укажите оксиды, при взаимодействии которых с водой образуются кислоты: а)NO, б)SO2, в)SiO2, г)CaO, д) CrO3.
1. а, б, в
2. б, в
3. в, г, д
4. б, д
5. в, д
вопрос 3. С какими из перечисленных веществ будет взаимодействовать разбавленная серная кислота: а)MgO, б)CO2, в)CaCl2 г)Al(OH)3, д)NaNO3?
1. а, б, в
2. б, в, г
3. в, г
4. б, д
5. а, в, г
Вопрос 4. С какими из перечисленных веществ будет взаимодействовать соляная кислота: а)Fe, б)AgNO3, в)Na2SO4, г)Cu, д)Ca(OH)2?
1. а, б, д
2. б, в, г
3. а, д
4. б, в, д
5. а, б
Вопрос 5. какие газы выделяются при взаимодействии меди с разбавленной H2SO4, концентрированной H2SO4, разбавленной HNO3, концентрированной HNO3 при комнатной температуре?
1. H2, SO2, NH3, NO
2. -, SO2, NO, NO2
3. H2, H2S, N2, NO2
4. -, H2S, N2O, NO
5. -, SO2, N2, N2O

Задание 5.
Вопрос 1. Из числа предложенных солей выберите формулы сульфата, сульфита, сульфида, гидросульфата: а)NaHSO3, б)LiHS, в)K2SO4, г)MgS, д)BaSO3, е)Na2S2O3, ж)KHSO4, з)Na2S2O8.
1. а, в, д, ж
2. б, г, е, з
3. в, г, д, ж
4. г, д, е, ж
5. а, д, ж, з
вопрос 2. Какие из перечисленных кислот могут давать как средние, так и кислые соли: а)HNO3, б)H2CO3, в)CH3COOH, г)H3PO4, д)HCl?
1. а, в, д
2. б, в
3. б, в, г
4. б, г
5. г, д
Вопрос 3. С какими из перечисленных веществ будет взаимодействовать растворенный сульфат меди: а)Ag, б)HCl, в)Mg, г)Fe2O3, д)KOH?
1. а, б, д
2. в, д
3. б, в, д
4. в, г, д
5. б, д
Вопрос 4. С какими из перечисленных веществ будет взаимодействовать раствор хлорида кальция: а)H2SO4, б)Fe, в)Na2CO3, г)SO2, д)Zn(OH)2?
1. б, в
2. а, б, г
3. а, в
4. а, б, в
5. в, д
Вопрос 5. какие из приведенных солей будут разлагаться при нагревании с выделением газов: а)CaCO3, б)K2CO3, в)K2SO4, г)Mg(NO3)2, д)LiClO4
1. а, б, г
2. б, в
3. в, г, д
4. а, г
5. г, д

задание 6.
Вопрос 1. Укажите электролиты, которые диссоциируют ступенчато: а)Mg(OH)2, б)HCl, в)MgCl2, г)H3PO4, д)Na3PO4, е)NaOH.
1. а, б, в
2. а, г
3. в, г, д
4. г, д, е
5. г, е
вопрос 2. Какие из приведенных соединений являются сильными электолитами: а) CaCl2, б)H2O, в)HNO3, г)KOH, д)H2CO3, е)Fe(OH)3, ж)CuSO4, з)CH3COOH
1. а, в, г, д
2. в, г, д, е
3. а, в, г, ж
4. в, г, д, ж
5. б, в, е, з
вопрос 3. Расположите формулы гидроксидов в порядке возрастания их кислотных свойств: а)H2SiO3, б)HClO4, в)H3PO4, г)H2SO4, д)Al(OH)3.
1. а, д, в, б, г
2. д, а, в, г, б
3. в, б, д, а, г
4. д, а, в, б, г
5. в, д, а, г, б
вопрос 4. Какая из приведенных реакций в растворах электролитов идет до конца:
1. BaCl2+Na2SO4=BaSO4+2NaCl
2. CaCO3+HCl=CaCl2+H2O+CO2
3. Ca(OH)2+2HNO3=Ca(NO3)2+2H2O
4. все реакции идут до конца
5. ни одна не идет до конца
Вопрос 5. В растворах каких из приведенных солей, лакмус покраснеет: а)Al(NO3)3, б)KCl, в)NH4Cl, г)Ba(NO3)2, д)Na2CO3?
1. а, в
2. а, б, в
3. в, г
4. в, г, д
5. б, в, г

задание 7
Вопрос 1. Найдите в периодической системе элементы, имеющие следующие конфигурации валентных электронов: 3d34s2; 5s2p3.
1. Cr, Sn
2. V, Sb
3. V, Nb
4. Nb, Sb
5. Nb, As
Вопрос 2. какому атому принадлежит последний валентный электрон, имеющий следующий набор квантовых чисел: n=3, l=1, ml=-1, ms=-1/2?
1. B
2. Al
3. S
4. P
5. Ar
Вопрос 3. укажите вещества, молекулы которых имеют плоскую конфигурацию из-за sp2- гибридизации центральных атомов: а)CH4, б)BCl3, в)H2SO4, г)SnCl2, д)C2H4.
1. а, б
2. б, г, д
3. г, д
4. б, в, г
5. б, д
Вопрос 4. укажите вещества с ковалентной полярной связью: а)NO, б)N2, в)KCl, г)H¬2S, д)OF2.
1. а, б, г
2. б, г
3. г, д
4. б, в, г
5. а, г, д
вопрос 5. В каком из указанных соединений имеется ковалентная связь, образованная по донорно-акцепторному механизму?
1. KNO3
2. NaCl
3. NH4Cl
4. CuCl2
5. HgSO4

задание 8
Вопрос 1. Реакция какого типа всегда является окислительно-восстановительной?
1. реакция соединения (NH3+HCl=NH4Cl)
2. реакция разложения (CaCO3=CaO+CO2)
3. реакция обмена (HCl+KOH=KCl+H2O)
4. реакция замещения (Zn+CuCl2=Cu+ZnCl2)
5. реакция образования комплекса {Cu(OH)2+4NH3=[Cu(NH3)4](OH)2}
вопрос 2. Расположите приведенные вещества в порядке возрастания степени окисления марганца: а)KMnO4, б)Mn, в)MnO2, г)K2MnO4, д)MnO.
1. д, б, в, а, г
2. б, д, в, а, г
3. б, в, д, г, а
4. б, д, в, г, а
5. в, д, б, а,г
вопрос 3. Какой из приведенных процессов является процессом восстановления:
1. As-3 As+3
2. Sn+4 Sn+2
3. Cr+3 Cr+6
4. S+4 S+6
5. N0 N+2
Вопрос 4. В какой из указанных реакций сера окисляется?
1. S+Zn ZnS
2. 2S+C CS2
3. S+O2 SO2
4. H2+S H2S
5. Fe+S FeS
вопрос 5. Расставьте коэффициенты в уравнении: KMnO4+Na2SO3+H2SO4 K2SO4+Na2SO4+MnSO4+H2O. укажите сумму коэффициентов:
1. 19
2. 20
3. 23
4. 21
5. 25

Задание 9
Вопрос 1. укажите, какой заряд имеет ион-комплексообразователь в следующем координационном соединении — K[Pt(NH3)Cl5].
1. +3
2. +4
3. +5
4. +6
5. +7
Вопрос 2. В каком координационном соединении ион-комплексообразователь проявляет координационное число равное 6?
1. [Cu(NH3)4]Cl2
2. K2[Cd(CN)4]
3. [Co(NH3)4Cl2]Cl
4. K2[Hg(CN)4]
5. Na2[Zn(CN)4]
вопрос 3. Какое из комплексных соединений платины образует при диссоциации 3 свободных аниона хлора?
1. [Pt(NH3)2Cl4]
2. [Pt(NH3)3Cl3]Cl
3. [Pt(NH3)4Cl2]
4. K2[PtCl6]
5. [Pt(NH3)5Cl]Cl3
Вопрос 4. В каком из комплексных соединений заряд комплексного иона равен –2?
1. K[AgCl2]
2. [Ag(NH3)2]Cl
3. K3[Fe(CN)6]
4. [Co(NH3)5NO2]Cl2
5. K2[Co(CSN)4]
вопрос 5. Исходя из величины константы нестойкости (приложение 5), укажите, какой из приведенных комплексных ионов является наиболее прочным?
1. [Ag(NH3)2]+
2. [Ni(CN)4]2-
3. [HgI4]2-
4. [HgBr4]2-
5. [HgCl4]2-

Задание 10
Вопрос 1. пользуясь таблицей термодинамических характеристик некоторых веществ (приложение 2), рассчитайте энтальпии следующих реакций: а)CH4+2O2=CO2+2H2O, б)CH4+2H2O(г)= CO2+4H2. Укажите эндо- или экзотермическими являются эти реакции.
1. обе экзотермические
2. обе эндотермические
3. а) эндотермическая, б) экзотермическая
4. а) экзотермическая, б) эндотермическая
5. нет правильного ответа
вопрос 2. Не производя расчетов, определите знак изменения энтропии ( S) в следующих реакциях: а)CH4(г)+H2O(г)=CO(г)+3H2(г), б)C2H5OH(ж)=C2H4(г)+H2O(г), в)N2(г)+3H2(г)=2NH3(г).
1. а) S>0, б) S<0, в) S<0
2. а) S>0, б) S>0, в) S<0
3. а) S<0, б) S<0, в) S>0
4. а) S<0, б) S>0, в) S>0
5. а) S>0, б) S>0, в) S>0
вопрос 3. Пользуясь таблицей термодинамических характеристик определите изменение энергии Гиббса химических реакций: а) 2Ca+O2=2CaO, б) 2CO+O2=2CO2, в) N2+O2=2NO при стандартных условиях. укажите знак изменения G .
1. а) G<0, б) G<0, в) G<0
2. а) G>0, б) G>0, в) G>0
3. а) G>0, б) G<0, в) G<0
4. а) G<0, б) G<0, в) G>0
5. а) G<0, б) G>0, в) G<0
вопрос 4. Укажите, как изменится скорость химической реакции 2Н2+О2=2Н2О, если а) концентрацию водорода увеличить в два раза, б) температуру реакции повысить на 300 (температурный коэффициент реакции =2).
1. а) увеличится в 2 раза, б) увеличится в 4 раза
2. а) увеличится в 4 раза, б) увеличится в 8 раз
3. а) уменьшится в 2 раза, б) увеличится в 6 раз
4. а) уменьшится в 4 раза, б) увеличится в 8 раз
5. а) увеличится в 4 раза, б) уменьшится в 6 раз
Вопрос 5. Укажите, в какую сторону сместиться равновесие реакции N2(г)+3H2(г)=2NH3(г), Н<0, если а) увеличить в системе концентрацию аммиака, б) повысить температуру, в) увеличить давление в системе?
1. а) , б) , в)
2. а) , б) , в)
3. а) , б) , в)
4. а) , б) , в)
5. а) , б) , в)

стоимость данной учебной работы: 195 руб.

    Укажите Ваш e-mail (обязательно)! ПРОВЕРЯЙТЕ пожалуйста правильность написания своего адреса!

    Укажите № работы и вариант


    Соглашение * (обязательно) Федеральный закон ФЗ-152 от 07.02.2017 N 13-ФЗ
    Я ознакомился с Пользовательским соглашением и даю согласие на обработку своих персональных данных.


    Подтвердите, что Вы не бот

    выдержка из похожей работы

    Книга 1, общие теоретические основы, Качественный анализ», издание3-е(М,: Высшая школа,2005),При изучении аналитических реакций катионов и анализе их сме­ сей используетсякислотно-основнаяклассификация катионов погруппам, а при аналогичном изучении анионов — классификация,основанная на образовании малорастворимых солей бария и серебра, Охарактеризованы важнейшие аналитические реакции катионов,анионов и описания методик проведения этих реакций, Предусматривается проведение работ по следующим темам,Тема 1, анализ катионов первой, второй и третьей аналитических групп покислотно-основнойклассификации,Тема 11, анализ катионов четвертой, пятой, шестой аналитических групп покислотно-основнойклассификации,Тема 111, анализ смеси катионов всех шести аналитических групппо кислотно-основнойклассификации,Тема IV, качественный анализ анионов,Тема У, Анализ смесей катионов и анионов (качественный химиче­ ский анализ вещества),Данное издание рекомендует следующую последовательность про­ведения лабораторных работ по качественному химическому анализу,тест-контроляи контрольных работ,Занятие 1, Аналитические реакции катионов первой аналитическойгруппы по кислотно-основнойклассификации

    Студенческая. Учебная работа № 56041. Контрольная Химия — ХИ